C16H24FNO2 — CID 106810519
2-(cyclopropylamino)-2-ethyl-5-(4-fluorophenoxy)pentan-1-ol (PubChem CID 106810519) has the molecular formula C16H24FNO2 and a molecular weight of 281.37 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-ethyl-5-(4-fluorophenoxy)pentan-1-ol.
| Compound Name | 2-(cyclopropylamino)-2-ethyl-5-(4-fluorophenoxy)pentan-1-ol |
|---|---|
| PubChem CID | 106810519 |
| Molecular Formula | C16H24FNO2 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2-(cyclopropylamino)-2-ethyl-5-(4-fluorophenoxy)pentan-1-ol |
| SMILES | CCC(CO)(CCCOc1ccc(F)cc1)NC1CC1 |
| InChI | InChI=1S/C16H24FNO2/c1-2-16(12-19,18-14-6-7-14)10-3-11-20-15-8-4-13(17)5-9-15/h4-5,8-9,14,18-19H,2-3,6-7,10-12H2,1H3 |
| InChIKey | BCPCDGDDDVYEGF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|