C12H23F2NO2 — CID 106810677
2-(cyclopropylamino)-5-(2,2-difluoroethoxy)-2-ethylpentan-1-ol (PubChem CID 106810677) has the molecular formula C12H23F2NO2 and a molecular weight of 251.32 g/mol. Its IUPAC name is 2-(cyclopropylamino)-5-(2,2-difluoroethoxy)-2-ethylpentan-1-ol.
| Compound Name | 2-(cyclopropylamino)-5-(2,2-difluoroethoxy)-2-ethylpentan-1-ol |
|---|---|
| PubChem CID | 106810677 |
| Molecular Formula | C12H23F2NO2 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-(cyclopropylamino)-5-(2,2-difluoroethoxy)-2-ethylpentan-1-ol |
| SMILES | CCC(CO)(CCCOCC(F)F)NC1CC1 |
| InChI | InChI=1S/C12H23F2NO2/c1-2-12(9-16,15-10-4-5-10)6-3-7-17-8-11(13)14/h10-11,15-16H,2-9H2,1H3 |
| InChIKey | YMADVPAUDNDXJI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|