C10H17F2NO3 — CID 82006585
2-(cyclopropylamino)-4-(2,2-difluoroethoxy)-2-methylbutanoic acid (PubChem CID 82006585) has the molecular formula C10H17F2NO3 and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-(cyclopropylamino)-4-(2,2-difluoroethoxy)-2-methylbutanoic acid.
| Compound Name | 2-(cyclopropylamino)-4-(2,2-difluoroethoxy)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 82006585 |
| Molecular Formula | C10H17F2NO3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-(cyclopropylamino)-4-(2,2-difluoroethoxy)-2-methylbutanoic acid |
| SMILES | CC(CCOCC(F)F)(NC1CC1)C(=O)O |
| InChI | InChI=1S/C10H17F2NO3/c1-10(9(14)15,13-7-2-3-7)4-5-16-6-8(11)12/h7-8,13H,2-6H2,1H3,(H,14,15) |
| InChIKey | GZIOTYLMIDYVOQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|