C15H29NO4 — CID 106448855
2-(cyclopropylamino)-2-methyl-4-[2-(2-methylpropoxy)ethoxy]pentanoic acid (PubChem CID 106448855) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-methyl-4-[2-(2-methylpropoxy)ethoxy]pentanoic acid.
| Compound Name | 2-(cyclopropylamino)-2-methyl-4-[2-(2-methylpropoxy)ethoxy]pentanoic acid |
|---|---|
| PubChem CID | 106448855 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | 2-(cyclopropylamino)-2-methyl-4-[2-(2-methylpropoxy)ethoxy]pentanoic acid |
| SMILES | CC(C)COCCOC(C)CC(C)(NC1CC1)C(=O)O |
| InChI | InChI=1S/C15H29NO4/c1-11(2)10-19-7-8-20-12(3)9-15(4,14(17)18)16-13-5-6-13/h11-13,16H,5-10H2,1-4H3,(H,17,18) |
| InChIKey | HQSAQCNRAVQPMI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|