C12H25NO4 — CID 64720044
2-methyl-2-(methylamino)-4-(2-propoxyethoxy)pentanoic acid (PubChem CID 64720044) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-4-(2-propoxyethoxy)pentanoic acid.
| Compound Name | 2-methyl-2-(methylamino)-4-(2-propoxyethoxy)pentanoic acid |
|---|---|
| PubChem CID | 64720044 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 2-methyl-2-(methylamino)-4-(2-propoxyethoxy)pentanoic acid |
| SMILES | CCCOCCOC(C)CC(C)(NC)C(=O)O |
| InChI | InChI=1S/C12H25NO4/c1-5-6-16-7-8-17-10(2)9-12(3,13-4)11(14)15/h10,13H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | LUMPQKOPILKOEL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|