C12H20F2N2O — CID 106804902
2-(cyclopropylamino)-5-(2,2-difluoroethoxy)-2-ethylpentanenitrile (PubChem CID 106804902) has the molecular formula C12H20F2N2O and a molecular weight of 246.30 g/mol. Its IUPAC name is 2-(cyclopropylamino)-5-(2,2-difluoroethoxy)-2-ethylpentanenitrile.
| Compound Name | 2-(cyclopropylamino)-5-(2,2-difluoroethoxy)-2-ethylpentanenitrile |
|---|---|
| PubChem CID | 106804902 |
| Molecular Formula | C12H20F2N2O |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-(cyclopropylamino)-5-(2,2-difluoroethoxy)-2-ethylpentanenitrile |
| SMILES | CCC(C#N)(CCCOCC(F)F)NC1CC1 |
| InChI | InChI=1S/C12H20F2N2O/c1-2-12(9-15,16-10-4-5-10)6-3-7-17-8-11(13)14/h10-11,16H,2-8H2,1H3 |
| InChIKey | NDGSOXBQJUCDGD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|