C22H17NO10S — CID 172972778
1-[4-(9,10-dioxoanthracen-2-yl)oxybutanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 172972778) has the molecular formula C22H17NO10S and a molecular weight of 487.44 g/mol. Its IUPAC name is 1-[4-(9,10-dioxoanthracen-2-yl)oxybutanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[4-(9,10-dioxoanthracen-2-yl)oxybutanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 172972778 |
| Molecular Formula | C22H17NO10S |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 1-[4-(9,10-dioxoanthracen-2-yl)oxybutanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | O=C(CCCOc1ccc2c(c1)C(=O)c1ccccc1C2=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C22H17NO10S/c24-18-11-17(34(29,30)31)22(28)23(18)33-19(25)6-3-9-32-12-7-8-15-16(10-12)21(27)14-5-2-1-4-13(14)20(15)26/h1-2,4-5,7-8,10,17H,3,6,9,11H2,(H,29,30,31) |
| InChIKey | IRWXKOWOTUGIJV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 161.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|