C13H14N2O8S — CID 165024040
[3-(hydroxy-methylidene-oxo-λ6-sulfanyl)-2,5-dioxopyrrolidin-1-yl] 4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 165024040) has the molecular formula C13H14N2O8S and a molecular weight of 358.33 g/mol. Its IUPAC name is [3-(hydroxy-methylidene-oxo-λ6-sulfanyl)-2,5-dioxopyrrolidin-1-yl] 4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | [3-(hydroxy-methylidene-oxo-λ6-sulfanyl)-2,5-dioxopyrrolidin-1-yl] 4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 165024040 |
| Molecular Formula | C13H14N2O8S |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | [3-(hydroxy-methylidene-oxo-λ6-sulfanyl)-2,5-dioxopyrrolidin-1-yl] 4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | C=S(=O)(O)C1CC(=O)N(OC(=O)CCCN2C(=O)C=CC2=O)C1=O |
| InChI | InChI=1S/C13H14N2O8S/c1-24(21,22)8-7-11(18)15(13(8)20)23-12(19)3-2-6-14-9(16)4-5-10(14)17/h4-5,8H,1-3,6-7H2,(H,21,22) |
| InChIKey | LPIDSGOJVZZGFI-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|