C17H19NO6 — CID 121350325
6-(3-benzyl-2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexanoic acid (PubChem CID 121350325) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is 6-(3-benzyl-2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexanoic acid.
| Compound Name | 6-(3-benzyl-2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 121350325 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 6-(3-benzyl-2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)ON1C(=O)CC(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C17H19NO6/c19-14-11-13(10-12-6-2-1-3-7-12)17(23)18(14)24-16(22)9-5-4-8-15(20)21/h1-3,6-7,13H,4-5,8-11H2,(H,20,21) |
| InChIKey | ZSHRYQIUIQFOGH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|