C11H13NO6S — CID 90896057
7-(2,5-dioxo-3-sulfanylidenepyrrolidin-1-yl)oxy-7-oxoheptanoic acid (PubChem CID 90896057) has the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. Its IUPAC name is 7-(2,5-dioxo-3-sulfanylidenepyrrolidin-1-yl)oxy-7-oxoheptanoic acid.
| Compound Name | 7-(2,5-dioxo-3-sulfanylidenepyrrolidin-1-yl)oxy-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 90896057 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 7-(2,5-dioxo-3-sulfanylidenepyrrolidin-1-yl)oxy-7-oxoheptanoic acid |
| SMILES | O=C(O)CCCCCC(=O)ON1C(=O)CC(=S)C1=O |
| InChI | InChI=1S/C11H13NO6S/c13-8-6-7(19)11(17)12(8)18-10(16)5-3-1-2-4-9(14)15/h1-6H2,(H,14,15) |
| InChIKey | UBGXAHOVBKYKCS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|