C11H13NO7S — CID 87745853
5-O-(2,5-dioxo-3-sulfanylidenepyrrolidin-1-yl) 1-O-(2-hydroxyethyl) pentanedioate (PubChem CID 87745853) has the molecular formula C11H13NO7S and a molecular weight of 303.29 g/mol. Its IUPAC name is 5-O-(2,5-dioxo-3-sulfanylidenepyrrolidin-1-yl) 1-O-(2-hydroxyethyl) pentanedioate.
| Compound Name | 5-O-(2,5-dioxo-3-sulfanylidenepyrrolidin-1-yl) 1-O-(2-hydroxyethyl) pentanedioate |
|---|---|
| PubChem CID | 87745853 |
| Molecular Formula | C11H13NO7S |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 5-O-(2,5-dioxo-3-sulfanylidenepyrrolidin-1-yl) 1-O-(2-hydroxyethyl) pentanedioate |
| SMILES | O=C(CCCC(=O)ON1C(=O)CC(=S)C1=O)OCCO |
| InChI | InChI=1S/C11H13NO7S/c13-4-5-18-9(15)2-1-3-10(16)19-12-8(14)6-7(20)11(12)17/h13H,1-6H2 |
| InChIKey | NDMCRLGSILLZOV-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|