C19H23N2O8S3- — CID 58066964
2,5-dioxo-1-[8-oxo-10-(pyridin-2-yldisulfanyl)decanoyl]oxypyrrolidine-3-sulfonate (PubChem CID 58066964) has the molecular formula C19H23N2O8S3- and a molecular weight of 503.60 g/mol. Its IUPAC name is 2,5-dioxo-1-[8-oxo-10-(pyridin-2-yldisulfanyl)decanoyl]oxypyrrolidine-3-sulfonate.
| Compound Name | 2,5-dioxo-1-[8-oxo-10-(pyridin-2-yldisulfanyl)decanoyl]oxypyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 58066964 |
| Molecular Formula | C19H23N2O8S3- |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 2,5-dioxo-1-[8-oxo-10-(pyridin-2-yldisulfanyl)decanoyl]oxypyrrolidine-3-sulfonate |
| SMILES | O=C(CCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)[O-])C1=O)CCSSc1ccccn1 |
| InChI | InChI=1S/C19H24N2O8S3/c22-14(10-12-30-31-16-8-5-6-11-20-16)7-3-1-2-4-9-18(24)29-21-17(23)13-15(19(21)25)32(26,27)28/h5-6,8,11,15H,1-4,7,9-10,12-13H2,(H,26,27,28)/p-1 |
| InChIKey | FYFYCTQJHHGCOZ-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 150.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|