C19H22N3NaO10S3 — CID 23669820
sodium 2,5-dioxo-1-[6-oxo-6-[[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethoxy]ethyl]amino]hexanoyl]oxypyrrolidine-3-sulfonate (PubChem CID 23669820) has the molecular formula C19H22N3NaO10S3 and a molecular weight of 571.59 g/mol. Its IUPAC name is sodium 2,5-dioxo-1-[6-oxo-6-[[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethoxy]ethyl]amino]hexanoyl]oxypyrrolidine-3-sulfonate.
| Compound Name | sodium 2,5-dioxo-1-[6-oxo-6-[[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethoxy]ethyl]amino]hexanoyl]oxypyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 23669820 |
| Molecular Formula | C19H22N3NaO10S3 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.04 |
| IUPAC Name | sodium 2,5-dioxo-1-[6-oxo-6-[[2-oxo-2-[2-(pyridin-2-yldisulfanyl)ethoxy]ethyl]amino]hexanoyl]oxypyrrolidine-3-sulfonate |
| SMILES | O=C(CCCCC(=O)ON1C(=O)CC(S(=O)(=O)[O-])C1=O)NCC(=O)OCCSSc1ccccn1.[Na+] |
| InChI | InChI=1S/C19H23N3O10S3.Na/c23-14(21-12-18(26)31-9-10-33-34-15-6-3-4-8-20-15)5-1-2-7-17(25)32-22-16(24)11-13(19(22)27)35(28,29)30;/h3-4,6,8,13H,1-2,5,7,9-12H2,(H,21,23)(H,28,29,30);/q;+1/p-1 |
| InChIKey | QXAKCMSPGICIQR-UHFFFAOYSA-M |
| XLogP | -2.82 |
| TPSA | 189.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|