C10H21Cl2N3O3Pt — CID 144749170
5-(2,5-diaminopentanoylamino)pentanoic acid;dichloroplatinum (PubChem CID 144749170) has the molecular formula C10H21Cl2N3O3Pt and a molecular weight of 497.28 g/mol. Its IUPAC name is 5-(2,5-diaminopentanoylamino)pentanoic acid;dichloroplatinum.
| Compound Name | 5-(2,5-diaminopentanoylamino)pentanoic acid;dichloroplatinum |
|---|---|
| PubChem CID | 144749170 |
| Molecular Formula | C10H21Cl2N3O3Pt |
| Molecular Weight | 497.28 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 5-(2,5-diaminopentanoylamino)pentanoic acid;dichloroplatinum |
| SMILES | Cl[Pt]Cl.NCCCC(N)C(=O)NCCCCC(=O)O |
| InChI | InChI=1S/C10H21N3O3.2ClH.Pt/c11-6-3-4-8(12)10(16)13-7-2-1-5-9(14)15;;;/h8H,1-7,11-12H2,(H,13,16)(H,14,15);2*1H;/q;;;+2/p-2 |
| InChIKey | LJMYDHFGIZPJKL-UHFFFAOYSA-L |
| XLogP | 0.80 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|