C9H17N3O — CID 118953139
2,6-diamino-N-prop-2-ynylhexanamide (PubChem CID 118953139) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 2,6-diamino-N-prop-2-ynylhexanamide.
| Compound Name | 2,6-diamino-N-prop-2-ynylhexanamide |
|---|---|
| PubChem CID | 118953139 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 2,6-diamino-N-prop-2-ynylhexanamide |
| SMILES | C#CCNC(=O)C(N)CCCCN |
| InChI | InChI=1S/C9H17N3O/c1-2-7-12-9(13)8(11)5-3-4-6-10/h1,8H,3-7,10-11H2,(H,12,13) |
| InChIKey | GZGLWSCZCMKWKA-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|