C34H61N2O2+ — CID 69256464
tert-butyl N-[5-(1-methylpyridin-1-ium-4-yl)tricos-14-enyl]carbamate (PubChem CID 69256464) has the molecular formula C34H61N2O2+ and a molecular weight of 529.87 g/mol. Its IUPAC name is tert-butyl N-[5-(1-methylpyridin-1-ium-4-yl)tricos-14-enyl]carbamate.
| Compound Name | tert-butyl N-[5-(1-methylpyridin-1-ium-4-yl)tricos-14-enyl]carbamate |
|---|---|
| PubChem CID | 69256464 |
| Molecular Formula | C34H61N2O2+ |
| Molecular Weight | 529.87 g/mol |
| Exact Mass | 529.47 |
| IUPAC Name | tert-butyl N-[5-(1-methylpyridin-1-ium-4-yl)tricos-14-enyl]carbamate |
| SMILES | CCCCCCCCC=CCCCCCCCCC(CCCCNC(=O)OC(C)(C)C)c1cc[n+](C)cc1 |
| InChI | InChI=1S/C34H60N2O2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-31(32-26-29-36(5)30-27-32)25-22-23-28-35-33(37)38-34(2,3)4/h13-14,26-27,29-31H,6-12,15-25,28H2,1-5H3/p+1 |
| InChIKey | GNBNKQLBLABXJQ-UHFFFAOYSA-O |
| XLogP | 9.72 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.87 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|