C12H25N5O3 — CID 175801756
(2S)-5-(diaminomethylideneamino)-2-[[(2R)-3-methyl-2-(methylamino)butanoyl]amino]pentanoic acid (PubChem CID 175801756) has the molecular formula C12H25N5O3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2R)-3-methyl-2-(methylamino)butanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2R)-3-methyl-2-(methylamino)butanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 175801756 |
| Molecular Formula | C12H25N5O3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2R)-3-methyl-2-(methylamino)butanoyl]amino]pentanoic acid |
| SMILES | CN[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)C(C)C |
| InChI | InChI=1S/C12H25N5O3/c1-7(2)9(15-3)10(18)17-8(11(19)20)5-4-6-16-12(13)14/h7-9,15H,4-6H2,1-3H3,(H,17,18)(H,19,20)(H4,13,14,16)/t8-,9+/m0/s1 |
| InChIKey | YKJFYEGQHFPPEF-DTWKUNHWSA-N |
| XLogP | -1.15 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|