C13H24N4O9 — CID 122517059
(2S)-5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 122517059) has the molecular formula C13H24N4O9 and a molecular weight of 380.35 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 122517059 |
| Molecular Formula | C13H24N4O9 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-(methylamino)pentanoic acid;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN[C@@H](CCCN=C(N)N)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H16N4O2.C6H8O7/c1-10-5(6(12)13)3-2-4-11-7(8)9;7-3(8)1-6(13,5(11)12)2-4(9)10/h5,10H,2-4H2,1H3,(H,12,13)(H4,8,9,11);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t5-;/m0./s1 |
| InChIKey | IKRSOOFKIBPMNF-JEDNCBNOSA-N |
| XLogP | -2.54 |
| TPSA | 245.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|