C22H27Cl2N5O4 — CID 10117577
N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-[2-(2,4-dichlorophenyl)ethoxy]-5-hydroxy-4-methylbenzamide (PubChem CID 10117577) has the molecular formula C22H27Cl2N5O4 and a molecular weight of 496.40 g/mol. Its IUPAC name is N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-[2-(2,4-dichlorophenyl)ethoxy]-5-hydroxy-4-methylbenzamide.
| Compound Name | N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-[2-(2,4-dichlorophenyl)ethoxy]-5-hydroxy-4-methylbenzamide |
|---|---|
| PubChem CID | 10117577 |
| Molecular Formula | C22H27Cl2N5O4 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | N-[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-[2-(2,4-dichlorophenyl)ethoxy]-5-hydroxy-4-methylbenzamide |
| SMILES | Cc1c(O)cc(C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)cc1OCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H27Cl2N5O4/c1-12-18(30)9-14(21(32)29-17(20(25)31)3-2-7-28-22(26)27)10-19(12)33-8-6-13-4-5-15(23)11-16(13)24/h4-5,9-11,17,30H,2-3,6-8H2,1H3,(H2,25,31)(H,29,32)(H4,26,27,28)/t17-/m0/s1 |
| InChIKey | OISJAMAHNJLYMQ-KRWDZBQOSA-N |
| XLogP | 2.27 |
| TPSA | 166.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|