C20H22Cl2O4 — CID 91128436
ethyl 2-[2-(2,4-dichlorophenyl)ethoxy]-4-propan-2-yloxybenzoate (PubChem CID 91128436) has the molecular formula C20H22Cl2O4 and a molecular weight of 397.30 g/mol. Its IUPAC name is ethyl 2-[2-(2,4-dichlorophenyl)ethoxy]-4-propan-2-yloxybenzoate.
| Compound Name | ethyl 2-[2-(2,4-dichlorophenyl)ethoxy]-4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 91128436 |
| Molecular Formula | C20H22Cl2O4 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | ethyl 2-[2-(2,4-dichlorophenyl)ethoxy]-4-propan-2-yloxybenzoate |
| SMILES | CCOC(=O)c1ccc(OC(C)C)cc1OCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2O4/c1-4-24-20(23)17-8-7-16(26-13(2)3)12-19(17)25-10-9-14-5-6-15(21)11-18(14)22/h5-8,11-13H,4,9-10H2,1-3H3 |
| InChIKey | ONPCXSYRKZVRES-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |