C16H15Cl2NO3 — CID 141052915
2-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxybenzamide (PubChem CID 141052915) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxybenzamide.
| Compound Name | 2-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxybenzamide |
|---|---|
| PubChem CID | 141052915 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)c(OCCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO3/c1-21-12-4-5-13(16(19)20)15(9-12)22-7-6-10-2-3-11(17)8-14(10)18/h2-5,8-9H,6-7H2,1H3,(H2,19,20) |
| InChIKey | LPBHSECELSCKEQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |