C16H13Cl2NO5 — CID 18272979
(2-carbamoyl-5-methoxyphenyl) 2-(2,5-dichlorophenoxy)acetate (PubChem CID 18272979) has the molecular formula C16H13Cl2NO5 and a molecular weight of 370.19 g/mol. Its IUPAC name is (2-carbamoyl-5-methoxyphenyl) 2-(2,5-dichlorophenoxy)acetate.
| Compound Name | (2-carbamoyl-5-methoxyphenyl) 2-(2,5-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 18272979 |
| Molecular Formula | C16H13Cl2NO5 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | (2-carbamoyl-5-methoxyphenyl) 2-(2,5-dichlorophenoxy)acetate |
| SMILES | COc1ccc(C(N)=O)c(OC(=O)COc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H13Cl2NO5/c1-22-10-3-4-11(16(19)21)13(7-10)24-15(20)8-23-14-6-9(17)2-5-12(14)18/h2-7H,8H2,1H3,(H2,19,21) |
| InChIKey | ZUGZGUMMXKPDAW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|