C17H16Cl2O4 — CID 22052399
3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid (PubChem CID 22052399) has the molecular formula C17H16Cl2O4 and a molecular weight of 355.22 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid.
| Compound Name | 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid |
|---|---|
| PubChem CID | 22052399 |
| Molecular Formula | C17H16Cl2O4 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid |
| SMILES | CCOc1ccc(C(=O)O)cc1OCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2O4/c1-2-22-15-6-4-12(17(20)21)9-16(15)23-8-7-11-3-5-13(18)10-14(11)19/h3-6,9-10H,2,7-8H2,1H3,(H,20,21) |
| InChIKey | DJRAPHIFUIFIEB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |