3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid

C17H16Cl2O4 — CID 22052399

IUPAC3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid
SMILESCCOc1ccc(C(=O)O)cc1OCCc1ccc(Cl)cc1Cl
InChIInChI=1S/C17H16Cl2O4/c1-2-22-15-6-4-12(17(20)21)9-16(15)23-8-7-11-3-5-13(18)10-14(11)19/h3-6,9-10H,2,7-8H2,1H3,(H,20,21)
InChIKeyDJRAPHIFUIFIEB-UHFFFAOYSA-N
MW355.22 g/mol
LogP4.71
Rot. Bonds7

About 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid

3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid (PubChem CID 22052399) has the molecular formula C17H16Cl2O4 and a molecular weight of 355.22 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid.

Molecular Properties

Compound Name3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid
PubChem CID22052399
Molecular FormulaC17H16Cl2O4
Molecular Weight355.22 g/mol
Exact Mass354.04
IUPAC Name3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid
SMILESCCOc1ccc(C(=O)O)cc1OCCc1ccc(Cl)cc1Cl
InChIInChI=1S/C17H16Cl2O4/c1-2-22-15-6-4-12(17(20)21)9-16(15)23-8-7-11-3-5-13(18)10-14(11)19/h3-6,9-10H,2,7-8H2,1H3,(H,20,21)
InChIKeyDJRAPHIFUIFIEB-UHFFFAOYSA-N
XLogP4.71
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500355.22
LogP ≤ 54.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid?
The IUPAC name of 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid (CID 22052399) is 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid.
What is the SMILES notation for 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid?
The canonical SMILES for 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid is CCOc1ccc(C(=O)O)cc1OCCc1ccc(Cl)cc1Cl.
What is the InChIKey of 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid?
The InChIKey is DJRAPHIFUIFIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2O4/c1-2-22-15-6-4-12(17(20)21)9-16(15)23-8-7-11-3-5-13(18)10-14(11)19/h3-6,9-10H,2,7-8H2,1H3,(H,20,21).
What are the key properties of 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid?
3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid has a molecular weight of 355.22 g/mol, XLogP of 4.71, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,4-dichlorophenyl)ethoxy]-4-ethoxybenzoic acid is sourced from PubChem (CID 22052399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).