C20H21Cl2NO4 — CID 7516791
[2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 7516791) has the molecular formula C20H21Cl2NO4 and a molecular weight of 410.30 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 7516791 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CCC[C@H](NC(=O)COC(=O)COc1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C20H21Cl2NO4/c1-2-6-17(14-7-4-3-5-8-14)23-19(24)12-27-20(25)13-26-18-10-9-15(21)11-16(18)22/h3-5,7-11,17H,2,6,12-13H2,1H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | KORHKUQPEWWVJP-KRWDZBQOSA-N |
| XLogP | 4.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |