C21H22ClNO3 — CID 7518789
[2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate (PubChem CID 7518789) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7518789 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
| SMILES | CCC[C@H](NC(=O)COC(=O)/C=C/c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C21H22ClNO3/c1-2-8-19(17-10-4-3-5-11-17)23-20(24)15-26-21(25)14-13-16-9-6-7-12-18(16)22/h3-7,9-14,19H,2,8,15H2,1H3,(H,23,24)/b14-13+/t19-/m0/s1 |
| InChIKey | ZRGVTWXKQWYOIR-KQDNUWKFSA-N |
| XLogP | 4.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|