C14H16ClNO3 — CID 2413557
[2-oxo-2-(propylamino)ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate (PubChem CID 2413557) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is [2-oxo-2-(propylamino)ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(propylamino)ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2413557 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | [2-oxo-2-(propylamino)ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
| SMILES | CCCNC(=O)COC(=O)/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C14H16ClNO3/c1-2-9-16-13(17)10-19-14(18)8-7-11-5-3-4-6-12(11)15/h3-8H,2,9-10H2,1H3,(H,16,17)/b8-7+ |
| InChIKey | RUTQEHWENDOOEO-BQYQJAHWSA-N |
| XLogP | 2.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|