C11H9F3O5S — CID 156556995
2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethoxy]-6-sulfanylbenzoic acid (PubChem CID 156556995) has the molecular formula C11H9F3O5S and a molecular weight of 310.25 g/mol. Its IUPAC name is 2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethoxy]-6-sulfanylbenzoic acid.
| Compound Name | 2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethoxy]-6-sulfanylbenzoic acid |
|---|---|
| PubChem CID | 156556995 |
| Molecular Formula | C11H9F3O5S |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethoxy]-6-sulfanylbenzoic acid |
| SMILES | O=C(COc1cccc(S)c1C(=O)O)OCC(F)(F)F |
| InChI | InChI=1S/C11H9F3O5S/c12-11(13,14)5-19-8(15)4-18-6-2-1-3-7(20)9(6)10(16)17/h1-3,20H,4-5H2,(H,16,17) |
| InChIKey | RKAILYFUKLVUBX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|