methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate

C13H15F3O4 — CID 54424942

IUPACmethyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate
SMILESCOC(=O)c1c(OCC(F)(F)F)cccc1OC(C)C
InChIInChI=1S/C13H15F3O4/c1-8(2)20-10-6-4-5-9(11(10)12(17)18-3)19-7-13(14,15)16/h4-6,8H,7H2,1-3H3
InChIKeyWDKVVURHJQTHGQ-UHFFFAOYSA-N
MW292.25 g/mol
LogP3.20
Rot. Bonds5

About methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate

methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate (PubChem CID 54424942) has the molecular formula C13H15F3O4 and a molecular weight of 292.25 g/mol. Its IUPAC name is methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate.

Molecular Properties

Compound Namemethyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate
PubChem CID54424942
Molecular FormulaC13H15F3O4
Molecular Weight292.25 g/mol
Exact Mass292.09
IUPAC Namemethyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate
SMILESCOC(=O)c1c(OCC(F)(F)F)cccc1OC(C)C
InChIInChI=1S/C13H15F3O4/c1-8(2)20-10-6-4-5-9(11(10)12(17)18-3)19-7-13(14,15)16/h4-6,8H,7H2,1-3H3
InChIKeyWDKVVURHJQTHGQ-UHFFFAOYSA-N
XLogP3.20
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.25
LogP ≤ 53.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate?
The IUPAC name of methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate (CID 54424942) is methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate.
What is the SMILES notation for methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate?
The canonical SMILES for methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate is COC(=O)c1c(OCC(F)(F)F)cccc1OC(C)C.
What is the InChIKey of methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate?
The InChIKey is WDKVVURHJQTHGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3O4/c1-8(2)20-10-6-4-5-9(11(10)12(17)18-3)19-7-13(14,15)16/h4-6,8H,7H2,1-3H3.
What are the key properties of methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate?
methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate has a molecular weight of 292.25 g/mol, XLogP of 3.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-propan-2-yloxy-6-(2,2,2-trifluoroethoxy)benzoate is sourced from PubChem (CID 54424942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).