C16H12Cl2O2S — CID 79227558
3,5-dichloro-2-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)benzaldehyde (PubChem CID 79227558) has the molecular formula C16H12Cl2O2S and a molecular weight of 339.24 g/mol. Its IUPAC name is 3,5-dichloro-2-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)benzaldehyde.
| Compound Name | 3,5-dichloro-2-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 79227558 |
| Molecular Formula | C16H12Cl2O2S |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 3,5-dichloro-2-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)benzaldehyde |
| SMILES | O=Cc1cc(Cl)cc(Cl)c1OCC1Cc2ccccc2S1 |
| InChI | InChI=1S/C16H12Cl2O2S/c17-12-5-11(8-19)16(14(18)7-12)20-9-13-6-10-3-1-2-4-15(10)21-13/h1-5,7-8,13H,6,9H2 |
| InChIKey | GZLGBYWSZIYDEQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|