C18H19ClOS — CID 79228154
2-[[4-(chloromethyl)-2,6-dimethylphenoxy]methyl]-2,3-dihydro-1-benzothiophene (PubChem CID 79228154) has the molecular formula C18H19ClOS and a molecular weight of 318.87 g/mol. Its IUPAC name is 2-[[4-(chloromethyl)-2,6-dimethylphenoxy]methyl]-2,3-dihydro-1-benzothiophene.
| Compound Name | 2-[[4-(chloromethyl)-2,6-dimethylphenoxy]methyl]-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79228154 |
| Molecular Formula | C18H19ClOS |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[[4-(chloromethyl)-2,6-dimethylphenoxy]methyl]-2,3-dihydro-1-benzothiophene |
| SMILES | Cc1cc(CCl)cc(C)c1OCC1Cc2ccccc2S1 |
| InChI | InChI=1S/C18H19ClOS/c1-12-7-14(10-19)8-13(2)18(12)20-11-16-9-15-5-3-4-6-17(15)21-16/h3-8,16H,9-11H2,1-2H3 |
| InChIKey | SIPPUOLIXFODMS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|