C25H27ClF6N2O2 — CID 144677615
4-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzaldehyde;2-(methylamino)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 144677615) has the molecular formula C25H27ClF6N2O2 and a molecular weight of 536.94 g/mol. Its IUPAC name is 4-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzaldehyde;2-(methylamino)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 4-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzaldehyde;2-(methylamino)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 144677615 |
| Molecular Formula | C25H27ClF6N2O2 |
| Molecular Weight | 536.94 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 4-[(E)-3-(3-chloro-4,5-dimethylphenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzaldehyde;2-(methylamino)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CNCC(=O)NCC(F)(F)F.Cc1cc(/C=C/C(c2cc(C)c(C)c(Cl)c2)C(F)(F)F)ccc1C=O |
| InChI | InChI=1S/C20H18ClF3O.C5H9F3N2O/c1-12-9-17(10-19(21)14(12)3)18(20(22,23)24)7-5-15-4-6-16(11-25)13(2)8-15;1-9-2-4(11)10-3-5(6,7)8/h4-11,18H,1-3H3;9H,2-3H2,1H3,(H,10,11)/b7-5+; |
| InChIKey | SEPZPWWJOAIEGL-GZOLSCHFSA-N |
| XLogP | 6.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.94 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|