C25H15BrCl2F3NO2 — CID 123192665
2-[[2-bromo-4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 123192665) has the molecular formula C25H15BrCl2F3NO2 and a molecular weight of 569.20 g/mol. Its IUPAC name is 2-[[2-bromo-4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-bromo-4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 123192665 |
| Molecular Formula | C25H15BrCl2F3NO2 |
| Molecular Weight | 569.20 g/mol |
| Exact Mass | 566.96 |
| IUPAC Name | 2-[[2-bromo-4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc(C=CC(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C25H15BrCl2F3NO2/c26-22-9-14(6-8-21(25(29,30)31)16-10-17(27)12-18(28)11-16)5-7-15(22)13-32-23(33)19-3-1-2-4-20(19)24(32)34/h1-12,21H,13H2 |
| InChIKey | COAYYGTZRPADGX-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.20 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|