C11H13FN2O3 — CID 90731981
5-(3-amino-2-methoxy-3-oxopropyl)-2-fluorobenzamide (PubChem CID 90731981) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is 5-(3-amino-2-methoxy-3-oxopropyl)-2-fluorobenzamide.
| Compound Name | 5-(3-amino-2-methoxy-3-oxopropyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 90731981 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 5-(3-amino-2-methoxy-3-oxopropyl)-2-fluorobenzamide |
| SMILES | COC(Cc1ccc(F)c(C(N)=O)c1)C(N)=O |
| InChI | InChI=1S/C11H13FN2O3/c1-17-9(11(14)16)5-6-2-3-8(12)7(4-6)10(13)15/h2-4,9H,5H2,1H3,(H2,13,15)(H2,14,16) |
| InChIKey | ZPSGLSTZPUCVDL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |