C20H23F2NO2 — CID 170631472
6-[3-[1-(3,4-difluorophenyl)propan-2-ylamino]propyl]-3H-2-benzofuran-1-one;molecular hydrogen (PubChem CID 170631472) has the molecular formula C20H23F2NO2 and a molecular weight of 347.41 g/mol. Its IUPAC name is 6-[3-[1-(3,4-difluorophenyl)propan-2-ylamino]propyl]-3H-2-benzofuran-1-one;molecular hydrogen.
| Compound Name | 6-[3-[1-(3,4-difluorophenyl)propan-2-ylamino]propyl]-3H-2-benzofuran-1-one;molecular hydrogen |
|---|---|
| PubChem CID | 170631472 |
| Molecular Formula | C20H23F2NO2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 6-[3-[1-(3,4-difluorophenyl)propan-2-ylamino]propyl]-3H-2-benzofuran-1-one;molecular hydrogen |
| SMILES | CC(Cc1ccc(F)c(F)c1)NCCCc1ccc2c(c1)C(=O)OC2.[H][H] |
| InChI | InChI=1S/C20H21F2NO2.H2/c1-13(9-15-5-7-18(21)19(22)11-15)23-8-2-3-14-4-6-16-12-25-20(24)17(16)10-14;/h4-7,10-11,13,23H,2-3,8-9,12H2,1H3;1H |
| InChIKey | LEOCECMLZXKHDD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|