C17H27F2NO — CID 116760137
1-(3,4-difluorophenyl)-3-ethoxy-N,3-diethylpentan-2-amine (PubChem CID 116760137) has the molecular formula C17H27F2NO and a molecular weight of 299.41 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-ethoxy-N,3-diethylpentan-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)-3-ethoxy-N,3-diethylpentan-2-amine |
|---|---|
| PubChem CID | 116760137 |
| Molecular Formula | C17H27F2NO |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-ethoxy-N,3-diethylpentan-2-amine |
| SMILES | CCNC(Cc1ccc(F)c(F)c1)C(CC)(CC)OCC |
| InChI | InChI=1S/C17H27F2NO/c1-5-17(6-2,21-8-4)16(20-7-3)12-13-9-10-14(18)15(19)11-13/h9-11,16,20H,5-8,12H2,1-4H3 |
| InChIKey | YEKVMHTUZNQKJG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |