C16H26FNO — CID 116759095
3-ethoxy-N-ethyl-1-(3-fluorophenyl)-3-methylpentan-2-amine (PubChem CID 116759095) has the molecular formula C16H26FNO and a molecular weight of 267.39 g/mol. Its IUPAC name is 3-ethoxy-N-ethyl-1-(3-fluorophenyl)-3-methylpentan-2-amine.
| Compound Name | 3-ethoxy-N-ethyl-1-(3-fluorophenyl)-3-methylpentan-2-amine |
|---|---|
| PubChem CID | 116759095 |
| Molecular Formula | C16H26FNO |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 3-ethoxy-N-ethyl-1-(3-fluorophenyl)-3-methylpentan-2-amine |
| SMILES | CCNC(Cc1cccc(F)c1)C(C)(CC)OCC |
| InChI | InChI=1S/C16H26FNO/c1-5-16(4,19-7-3)15(18-6-2)12-13-9-8-10-14(17)11-13/h8-11,15,18H,5-7,12H2,1-4H3 |
| InChIKey | UBXPTKWVTDLFIN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |