C16H25ClO — CID 79442705
2-(3-chlorophenyl)-4-ethyloctan-1-ol (PubChem CID 79442705) has the molecular formula C16H25ClO and a molecular weight of 268.83 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-ethyloctan-1-ol.
| Compound Name | 2-(3-chlorophenyl)-4-ethyloctan-1-ol |
|---|---|
| PubChem CID | 79442705 |
| Molecular Formula | C16H25ClO |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-(3-chlorophenyl)-4-ethyloctan-1-ol |
| SMILES | CCCCC(CC)CC(CO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H25ClO/c1-3-5-7-13(4-2)10-15(12-18)14-8-6-9-16(17)11-14/h6,8-9,11,13,15,18H,3-5,7,10,12H2,1-2H3 |
| InChIKey | CZYQOZHELJPDSN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |