C13H14F6O2 — CID 103147587
4-(2,2,2-trifluoroethoxy)-1-[3-(trifluoromethyl)phenyl]butan-2-ol (PubChem CID 103147587) has the molecular formula C13H14F6O2 and a molecular weight of 316.24 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethoxy)-1-[3-(trifluoromethyl)phenyl]butan-2-ol.
| Compound Name | 4-(2,2,2-trifluoroethoxy)-1-[3-(trifluoromethyl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 103147587 |
| Molecular Formula | C13H14F6O2 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-(2,2,2-trifluoroethoxy)-1-[3-(trifluoromethyl)phenyl]butan-2-ol |
| SMILES | OC(CCOCC(F)(F)F)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F6O2/c14-12(15,16)8-21-5-4-11(20)7-9-2-1-3-10(6-9)13(17,18)19/h1-3,6,11,20H,4-5,7-8H2 |
| InChIKey | DSOXPQNDWBTSAD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|