C13H17F5N2O — CID 103151932
[4-(2,2-difluoroethoxy)-1-[3-(trifluoromethyl)phenyl]butan-2-yl]hydrazine (PubChem CID 103151932) has the molecular formula C13H17F5N2O and a molecular weight of 312.28 g/mol. Its IUPAC name is [4-(2,2-difluoroethoxy)-1-[3-(trifluoromethyl)phenyl]butan-2-yl]hydrazine.
| Compound Name | [4-(2,2-difluoroethoxy)-1-[3-(trifluoromethyl)phenyl]butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103151932 |
| Molecular Formula | C13H17F5N2O |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [4-(2,2-difluoroethoxy)-1-[3-(trifluoromethyl)phenyl]butan-2-yl]hydrazine |
| SMILES | NNC(CCOCC(F)F)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F5N2O/c14-12(15)8-21-5-4-11(20-19)7-9-2-1-3-10(6-9)13(16,17)18/h1-3,6,11-12,20H,4-5,7-8,19H2 |
| InChIKey | DYMPCSUUUVLBLZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|