C16H23FO2 — CID 79440327
4-ethyl-2-(3-fluorophenyl)octanoic acid (PubChem CID 79440327) has the molecular formula C16H23FO2 and a molecular weight of 266.36 g/mol. Its IUPAC name is 4-ethyl-2-(3-fluorophenyl)octanoic acid.
| Compound Name | 4-ethyl-2-(3-fluorophenyl)octanoic acid |
|---|---|
| PubChem CID | 79440327 |
| Molecular Formula | C16H23FO2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 4-ethyl-2-(3-fluorophenyl)octanoic acid |
| SMILES | CCCCC(CC)CC(C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C16H23FO2/c1-3-5-7-12(4-2)10-15(16(18)19)13-8-6-9-14(17)11-13/h6,8-9,11-12,15H,3-5,7,10H2,1-2H3,(H,18,19) |
| InChIKey | ZILUISVNJWDQMH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |