About 4-ethyl-2-phenylhexanoic acid
4-ethyl-2-phenylhexanoic acid (PubChem CID 81009184) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 4-ethyl-2-phenylhexanoic acid.
Molecular Properties
| Compound Name | 4-ethyl-2-phenylhexanoic acid |
| PubChem CID | 81009184 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 4-ethyl-2-phenylhexanoic acid |
| SMILES | CCC(CC)CC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H20O2/c1-3-11(4-2)10-13(14(15)16)12-8-6-5-7-9-12/h5-9,11,13H,3-4,10H2,1-2H3,(H,15,16) |
| InChIKey | RNIGFXSDDBUCHQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-2-phenylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-phenylhexanoic acid?
The IUPAC name of 4-ethyl-2-phenylhexanoic acid (CID 81009184) is 4-ethyl-2-phenylhexanoic acid.
What is the SMILES notation for 4-ethyl-2-phenylhexanoic acid?
The canonical SMILES for 4-ethyl-2-phenylhexanoic acid is CCC(CC)CC(C(=O)O)c1ccccc1.
What is the InChIKey of 4-ethyl-2-phenylhexanoic acid?
The InChIKey is RNIGFXSDDBUCHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-3-11(4-2)10-13(14(15)16)12-8-6-5-7-9-12/h5-9,11,13H,3-4,10H2,1-2H3,(H,15,16).
What are the key properties of 4-ethyl-2-phenylhexanoic acid?
4-ethyl-2-phenylhexanoic acid has a molecular weight of 220.31 g/mol, XLogP of 3.68, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-phenylhexanoic acid is sourced from PubChem (CID 81009184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).