About 4-iodo-2-phenylpentanoic acid
4-iodo-2-phenylpentanoic acid (PubChem CID 134988411) has the molecular formula C11H13IO2
and a molecular weight of 304.13 g/mol. Its IUPAC name is 4-iodo-2-phenylpentanoic acid.
Molecular Properties
| Compound Name | 4-iodo-2-phenylpentanoic acid |
| PubChem CID | 134988411 |
| Molecular Formula | C11H13IO2 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 4-iodo-2-phenylpentanoic acid |
| SMILES | CC(I)CC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H13IO2/c1-8(12)7-10(11(13)14)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3,(H,13,14) |
| InChIKey | WNWKWBMZSLTSPO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-2-phenylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-2-phenylpentanoic acid?
The IUPAC name of 4-iodo-2-phenylpentanoic acid (CID 134988411) is 4-iodo-2-phenylpentanoic acid.
What is the SMILES notation for 4-iodo-2-phenylpentanoic acid?
The canonical SMILES for 4-iodo-2-phenylpentanoic acid is CC(I)CC(C(=O)O)c1ccccc1.
What is the InChIKey of 4-iodo-2-phenylpentanoic acid?
The InChIKey is WNWKWBMZSLTSPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13IO2/c1-8(12)7-10(11(13)14)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3,(H,13,14).
What are the key properties of 4-iodo-2-phenylpentanoic acid?
4-iodo-2-phenylpentanoic acid has a molecular weight of 304.13 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-2-phenylpentanoic acid is sourced from PubChem (CID 134988411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).