C12H13ClF3IO — CID 114774807
1-chloro-4-[2-iodo-1-(4,4,4-trifluorobutoxy)ethyl]benzene (PubChem CID 114774807) has the molecular formula C12H13ClF3IO and a molecular weight of 392.59 g/mol. Its IUPAC name is 1-chloro-4-[2-iodo-1-(4,4,4-trifluorobutoxy)ethyl]benzene.
| Compound Name | 1-chloro-4-[2-iodo-1-(4,4,4-trifluorobutoxy)ethyl]benzene |
|---|---|
| PubChem CID | 114774807 |
| Molecular Formula | C12H13ClF3IO |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | 1-chloro-4-[2-iodo-1-(4,4,4-trifluorobutoxy)ethyl]benzene |
| SMILES | FC(F)(F)CCCOC(CI)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClF3IO/c13-10-4-2-9(3-5-10)11(8-17)18-7-1-6-12(14,15)16/h2-5,11H,1,6-8H2 |
| InChIKey | AOZFWJBBMLSXLD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|