C11H11F4IO — CID 114774977
1-fluoro-2-[2-iodo-1-(3,3,3-trifluoropropoxy)ethyl]benzene (PubChem CID 114774977) has the molecular formula C11H11F4IO and a molecular weight of 362.10 g/mol. Its IUPAC name is 1-fluoro-2-[2-iodo-1-(3,3,3-trifluoropropoxy)ethyl]benzene.
| Compound Name | 1-fluoro-2-[2-iodo-1-(3,3,3-trifluoropropoxy)ethyl]benzene |
|---|---|
| PubChem CID | 114774977 |
| Molecular Formula | C11H11F4IO |
| Molecular Weight | 362.10 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 1-fluoro-2-[2-iodo-1-(3,3,3-trifluoropropoxy)ethyl]benzene |
| SMILES | Fc1ccccc1C(CI)OCCC(F)(F)F |
| InChI | InChI=1S/C11H11F4IO/c12-9-4-2-1-3-8(9)10(7-16)17-6-5-11(13,14)15/h1-4,10H,5-7H2 |
| InChIKey | HVDWJDXYTNQFDM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.10 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|