C10H13ClNO5P — CID 101411104
[1-(4-chlorophenyl)-3-[formyl(hydroxy)amino]propyl]phosphonic acid (PubChem CID 101411104) has the molecular formula C10H13ClNO5P and a molecular weight of 293.64 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-3-[formyl(hydroxy)amino]propyl]phosphonic acid.
| Compound Name | [1-(4-chlorophenyl)-3-[formyl(hydroxy)amino]propyl]phosphonic acid |
|---|---|
| PubChem CID | 101411104 |
| Molecular Formula | C10H13ClNO5P |
| Molecular Weight | 293.64 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | [1-(4-chlorophenyl)-3-[formyl(hydroxy)amino]propyl]phosphonic acid |
| SMILES | O=CN(O)CCC(c1ccc(Cl)cc1)P(=O)(O)O |
| InChI | InChI=1S/C10H13ClNO5P/c11-9-3-1-8(2-4-9)10(18(15,16)17)5-6-12(14)7-13/h1-4,7,10,14H,5-6H2,(H2,15,16,17) |
| InChIKey | OILGWUKACLDUGC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.64 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|