C14H20ClO5P — CID 23420723
4-(4-chlorophenyl)-1-diethoxyphosphoryl-4-hydroxybutan-2-one (PubChem CID 23420723) has the molecular formula C14H20ClO5P and a molecular weight of 334.74 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-diethoxyphosphoryl-4-hydroxybutan-2-one.
| Compound Name | 4-(4-chlorophenyl)-1-diethoxyphosphoryl-4-hydroxybutan-2-one |
|---|---|
| PubChem CID | 23420723 |
| Molecular Formula | C14H20ClO5P |
| Molecular Weight | 334.74 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-(4-chlorophenyl)-1-diethoxyphosphoryl-4-hydroxybutan-2-one |
| SMILES | CCOP(=O)(CC(=O)CC(O)c1ccc(Cl)cc1)OCC |
| InChI | InChI=1S/C14H20ClO5P/c1-3-19-21(18,20-4-2)10-13(16)9-14(17)11-5-7-12(15)8-6-11/h5-8,14,17H,3-4,9-10H2,1-2H3 |
| InChIKey | HSRRCQLAOILMPS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|