C13H10Br3ClS — CID 114021686
2,5-dibromo-3-[bromo-(2-chloro-4,5-dimethylphenyl)methyl]thiophene (PubChem CID 114021686) has the molecular formula C13H10Br3ClS and a molecular weight of 473.46 g/mol. Its IUPAC name is 2,5-dibromo-3-[bromo-(2-chloro-4,5-dimethylphenyl)methyl]thiophene.
| Compound Name | 2,5-dibromo-3-[bromo-(2-chloro-4,5-dimethylphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 114021686 |
| Molecular Formula | C13H10Br3ClS |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 469.77 |
| IUPAC Name | 2,5-dibromo-3-[bromo-(2-chloro-4,5-dimethylphenyl)methyl]thiophene |
| SMILES | Cc1cc(Cl)c(C(Br)c2cc(Br)sc2Br)cc1C |
| InChI | InChI=1S/C13H10Br3ClS/c1-6-3-8(10(17)4-7(6)2)12(15)9-5-11(14)18-13(9)16/h3-5,12H,1-2H3 |
| InChIKey | PUVVOADVLBNBMI-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|