C16H17Br3S — CID 107964619
2,5-dibromo-3-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]thiophene (PubChem CID 107964619) has the molecular formula C16H17Br3S and a molecular weight of 481.09 g/mol. Its IUPAC name is 2,5-dibromo-3-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]thiophene.
| Compound Name | 2,5-dibromo-3-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 107964619 |
| Molecular Formula | C16H17Br3S |
| Molecular Weight | 481.09 g/mol |
| Exact Mass | 477.86 |
| IUPAC Name | 2,5-dibromo-3-[bromo-(2,3,4,5,6-pentamethylphenyl)methyl]thiophene |
| SMILES | Cc1c(C)c(C)c(C(Br)c2cc(Br)sc2Br)c(C)c1C |
| InChI | InChI=1S/C16H17Br3S/c1-7-8(2)10(4)14(11(5)9(7)3)15(18)12-6-13(17)20-16(12)19/h6,15H,1-5H3 |
| InChIKey | JIQCPVBEFNCEIT-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.09 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|