C12H8Br4OS — CID 114021645
2,5-dibromo-3-[bromo-(2-bromo-4-methoxyphenyl)methyl]thiophene (PubChem CID 114021645) has the molecular formula C12H8Br4OS and a molecular weight of 519.88 g/mol. Its IUPAC name is 2,5-dibromo-3-[bromo-(2-bromo-4-methoxyphenyl)methyl]thiophene.
| Compound Name | 2,5-dibromo-3-[bromo-(2-bromo-4-methoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 114021645 |
| Molecular Formula | C12H8Br4OS |
| Molecular Weight | 519.88 g/mol |
| Exact Mass | 515.70 |
| IUPAC Name | 2,5-dibromo-3-[bromo-(2-bromo-4-methoxyphenyl)methyl]thiophene |
| SMILES | COc1ccc(C(Br)c2cc(Br)sc2Br)c(Br)c1 |
| InChI | InChI=1S/C12H8Br4OS/c1-17-6-2-3-7(9(13)4-6)11(15)8-5-10(14)18-12(8)16/h2-5,11H,1H3 |
| InChIKey | XHMWOEDNYHBTIX-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.88 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|