C16H15Br2Cl — CID 113319689
1-[bromo-(4-bromo-2-methylphenyl)methyl]-2-chloro-4,5-dimethylbenzene (PubChem CID 113319689) has the molecular formula C16H15Br2Cl and a molecular weight of 402.56 g/mol. Its IUPAC name is 1-[bromo-(4-bromo-2-methylphenyl)methyl]-2-chloro-4,5-dimethylbenzene.
| Compound Name | 1-[bromo-(4-bromo-2-methylphenyl)methyl]-2-chloro-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 113319689 |
| Molecular Formula | C16H15Br2Cl |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | 1-[bromo-(4-bromo-2-methylphenyl)methyl]-2-chloro-4,5-dimethylbenzene |
| SMILES | Cc1cc(Cl)c(C(Br)c2ccc(Br)cc2C)cc1C |
| InChI | InChI=1S/C16H15Br2Cl/c1-9-7-14(15(19)8-10(9)2)16(18)13-5-4-12(17)6-11(13)3/h4-8,16H,1-3H3 |
| InChIKey | FYTBXNDIDRWVJI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|